C21H30F2N2O2 — CID 58969799
4,4-difluoro-N-[3-[(3-methyl-2-oxobutyl)amino]-1-phenylpropyl]cyclohexane-1-carboxamide (PubChem CID 58969799) has the molecular formula C21H30F2N2O2 and a molecular weight of 380.48 g/mol. Its IUPAC name is 4,4-difluoro-N-[3-[(3-methyl-2-oxobutyl)amino]-1-phenylpropyl]cyclohexane-1-carboxamide.
| Compound Name | 4,4-difluoro-N-[3-[(3-methyl-2-oxobutyl)amino]-1-phenylpropyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58969799 |
| Molecular Formula | C21H30F2N2O2 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 4,4-difluoro-N-[3-[(3-methyl-2-oxobutyl)amino]-1-phenylpropyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)C(=O)CNCCC(NC(=O)C1CCC(F)(F)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H30F2N2O2/c1-15(2)19(26)14-24-13-10-18(16-6-4-3-5-7-16)25-20(27)17-8-11-21(22,23)12-9-17/h3-7,15,17-18,24H,8-14H2,1-2H3,(H,25,27) |
| InChIKey | ZRLSHAZOQHNKIB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|