C28H40N4 — CID 176954877
6-amino-2-[4-[butyl(propyl)amino]-2-ethyl-5,6,7,8-tetrahydroquinolin-7-yl]-3-propylbenzonitrile (PubChem CID 176954877) has the molecular formula C28H40N4 and a molecular weight of 432.66 g/mol. Its IUPAC name is 6-amino-2-[4-[butyl(propyl)amino]-2-ethyl-5,6,7,8-tetrahydroquinolin-7-yl]-3-propylbenzonitrile.
| Compound Name | 6-amino-2-[4-[butyl(propyl)amino]-2-ethyl-5,6,7,8-tetrahydroquinolin-7-yl]-3-propylbenzonitrile |
|---|---|
| PubChem CID | 176954877 |
| Molecular Formula | C28H40N4 |
| Molecular Weight | 432.66 g/mol |
| Exact Mass | 432.33 |
| IUPAC Name | 6-amino-2-[4-[butyl(propyl)amino]-2-ethyl-5,6,7,8-tetrahydroquinolin-7-yl]-3-propylbenzonitrile |
| SMILES | CCCCN(CCC)c1cc(CC)nc2c1CCC(c1c(CCC)ccc(N)c1C#N)C2 |
| InChI | InChI=1S/C28H40N4/c1-5-9-16-32(15-7-3)27-18-22(8-4)31-26-17-21(11-13-23(26)27)28-20(10-6-2)12-14-25(30)24(28)19-29/h12,14,18,21H,5-11,13,15-17,30H2,1-4H3 |
| InChIKey | HXXRRKSIXIDSMC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.66 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|