C21H28BN2O5 — CID 176955615
CID 176955615 (PubChem CID 176955615) has the molecular formula C21H28BN2O5 and a molecular weight of 399.28 g/mol.
| Compound Name | CID 176955615 |
|---|---|
| PubChem CID | 176955615 |
| Molecular Formula | C21H28BN2O5 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | — |
| SMILES | C#CCOCCOCCOCCOCCC(=O)NCc1ccccc1C[B]C#N |
| InChI | InChI=1S/C21H28BN2O5/c1-2-8-26-10-12-28-14-15-29-13-11-27-9-7-21(25)24-17-20-6-4-3-5-19(20)16-22-18-23/h1,3-6H,7-17H2,(H,24,25) |
| InChIKey | CSEFXELYSHABJV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|