C8H15NS — CID 176957504
1-[[(1E)-2,3-dimethylbuta-1,3-dienyl]amino]ethanethiol (PubChem CID 176957504) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is 1-[[(1E)-2,3-dimethylbuta-1,3-dienyl]amino]ethanethiol.
| Compound Name | 1-[[(1E)-2,3-dimethylbuta-1,3-dienyl]amino]ethanethiol |
|---|---|
| PubChem CID | 176957504 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 1-[[(1E)-2,3-dimethylbuta-1,3-dienyl]amino]ethanethiol |
| SMILES | C=C(C)/C(C)=C/NC(C)S |
| InChI | InChI=1S/C8H15NS/c1-6(2)7(3)5-9-8(4)10/h5,8-10H,1H2,2-4H3/b7-5+ |
| InChIKey | PQPKPJGGBMDKOP-FNORWQNLSA-N |
| XLogP | 2.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|