C11H18N2 — CID 176957917
(1E,2Z,6Z)-8-tert-butyl-4,5-dihydroazocin-2-amine (PubChem CID 176957917) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (1E,2Z,6Z)-8-tert-butyl-4,5-dihydroazocin-2-amine.
| Compound Name | (1E,2Z,6Z)-8-tert-butyl-4,5-dihydroazocin-2-amine |
|---|---|
| PubChem CID | 176957917 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (1E,2Z,6Z)-8-tert-butyl-4,5-dihydroazocin-2-amine |
| SMILES | CC(C)(C)C1=N/C(N)=C\CC/C=C\1 |
| InChI | InChI=1S/C11H18N2/c1-11(2,3)9-7-5-4-6-8-10(12)13-9/h5,7-8H,4,6,12H2,1-3H3/b7-5-,10-8-,13-9+ |
| InChIKey | AOAOFOJGELAIIZ-XZLBKBBJSA-N |
| XLogP | 2.62 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |