C17H21F2N3O2 — CID 176958541
tert-butyl (3Z)-3-(aminomethylidene)-4-[(2,4-difluorophenyl)methylimino]pyrrolidine-1-carboxylate (PubChem CID 176958541) has the molecular formula C17H21F2N3O2 and a molecular weight of 337.37 g/mol. Its IUPAC name is tert-butyl (3Z)-3-(aminomethylidene)-4-[(2,4-difluorophenyl)methylimino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3Z)-3-(aminomethylidene)-4-[(2,4-difluorophenyl)methylimino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 176958541 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | tert-butyl (3Z)-3-(aminomethylidene)-4-[(2,4-difluorophenyl)methylimino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=C/N)/C(=N/Cc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C17H21F2N3O2/c1-17(2,3)24-16(23)22-9-12(7-20)15(10-22)21-8-11-4-5-13(18)6-14(11)19/h4-7H,8-10,20H2,1-3H3/b12-7-,21-15+ |
| InChIKey | HDYGVBKCLONFII-ORIZGQKRSA-N |
| XLogP | 3.00 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|