C7H13N2O2- — CID 176958706
3-[2-(oxidoamino)propyl]pyrrolidin-2-one (PubChem CID 176958706) has the molecular formula C7H13N2O2- and a molecular weight of 157.19 g/mol. Its IUPAC name is 3-[2-(oxidoamino)propyl]pyrrolidin-2-one.
| Compound Name | 3-[2-(oxidoamino)propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 176958706 |
| Molecular Formula | C7H13N2O2- |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | 3-[2-(oxidoamino)propyl]pyrrolidin-2-one |
| SMILES | CC(CC1CCNC1=O)N[O-] |
| InChI | InChI=1S/C7H13N2O2/c1-5(9-11)4-6-2-3-8-7(6)10/h5-6,9H,2-4H2,1H3,(H,8,10)/q-1 |
| InChIKey | KSMSSKYPJGZJTR-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|