C16H21N5O4 — CID 176960057
methyl N-[[1-[[2-methoxy-4-[(E)-N'-methoxycarbamimidoyl]phenyl]methyl]pyrazol-4-yl]methyl]carbamate (PubChem CID 176960057) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is methyl N-[[1-[[2-methoxy-4-[(E)-N'-methoxycarbamimidoyl]phenyl]methyl]pyrazol-4-yl]methyl]carbamate.
| Compound Name | methyl N-[[1-[[2-methoxy-4-[(E)-N'-methoxycarbamimidoyl]phenyl]methyl]pyrazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 176960057 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | methyl N-[[1-[[2-methoxy-4-[(E)-N'-methoxycarbamimidoyl]phenyl]methyl]pyrazol-4-yl]methyl]carbamate |
| SMILES | CO/N=C(/N)c1ccc(Cn2cc(CNC(=O)OC)cn2)c(OC)c1 |
| InChI | InChI=1S/C16H21N5O4/c1-23-14-6-12(15(17)20-25-3)4-5-13(14)10-21-9-11(8-19-21)7-18-16(22)24-2/h4-6,8-9H,7,10H2,1-3H3,(H2,17,20)(H,18,22) |
| InChIKey | XGBLBAIWJLKYTD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|