C10H13N3O4 — CID 175135937
[4-(N'-hydroxycarbamimidoyl)-2-methoxyphenyl]methyl carbamate (PubChem CID 175135937) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is [4-(N'-hydroxycarbamimidoyl)-2-methoxyphenyl]methyl carbamate.
| Compound Name | [4-(N'-hydroxycarbamimidoyl)-2-methoxyphenyl]methyl carbamate |
|---|---|
| PubChem CID | 175135937 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | [4-(N'-hydroxycarbamimidoyl)-2-methoxyphenyl]methyl carbamate |
| SMILES | COc1cc(C(N)=NO)ccc1COC(N)=O |
| InChI | InChI=1S/C10H13N3O4/c1-16-8-4-6(9(11)13-15)2-3-7(8)5-17-10(12)14/h2-4,15H,5H2,1H3,(H2,11,13)(H2,12,14) |
| InChIKey | OIMQSOPVSBBTNF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|