C17H22F3N5O3S2 — CID 176961379
[2-tert-butyl-5-[2-(piperidin-4-ylamino)pyrimidin-4-yl]-1,3-thiazol-4-yl] trifluoromethanesulfonate (PubChem CID 176961379) has the molecular formula C17H22F3N5O3S2 and a molecular weight of 465.52 g/mol. Its IUPAC name is [2-tert-butyl-5-[2-(piperidin-4-ylamino)pyrimidin-4-yl]-1,3-thiazol-4-yl] trifluoromethanesulfonate.
| Compound Name | [2-tert-butyl-5-[2-(piperidin-4-ylamino)pyrimidin-4-yl]-1,3-thiazol-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 176961379 |
| Molecular Formula | C17H22F3N5O3S2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | [2-tert-butyl-5-[2-(piperidin-4-ylamino)pyrimidin-4-yl]-1,3-thiazol-4-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1nc(OS(=O)(=O)C(F)(F)F)c(-c2ccnc(NC3CCNCC3)n2)s1 |
| InChI | InChI=1S/C17H22F3N5O3S2/c1-16(2,3)14-25-13(28-30(26,27)17(18,19)20)12(29-14)11-6-9-22-15(24-11)23-10-4-7-21-8-5-10/h6,9-10,21H,4-5,7-8H2,1-3H3,(H,22,23,24) |
| InChIKey | GGQWPLJQBJNDKA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|