C13H19N — CID 176961452
3-propan-2-yl-10-azatricyclo[4.4.1.03,11]undeca-6(11),9-diene (PubChem CID 176961452) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 3-propan-2-yl-10-azatricyclo[4.4.1.03,11]undeca-6(11),9-diene.
| Compound Name | 3-propan-2-yl-10-azatricyclo[4.4.1.03,11]undeca-6(11),9-diene |
|---|---|
| PubChem CID | 176961452 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 3-propan-2-yl-10-azatricyclo[4.4.1.03,11]undeca-6(11),9-diene |
| SMILES | CC(C)C12CCC3=C1C(C2)N=CCC3 |
| InChI | InChI=1S/C13H19N/c1-9(2)13-6-5-10-4-3-7-14-11(8-13)12(10)13/h7,9,11H,3-6,8H2,1-2H3 |
| InChIKey | ZHSWEMMMRXIIIY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|