C14H23N — CID 101141415
4,7-ditert-butyl-6-azabicyclo[3.2.0]hepta-3,6-diene (PubChem CID 101141415) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 4,7-ditert-butyl-6-azabicyclo[3.2.0]hepta-3,6-diene.
| Compound Name | 4,7-ditert-butyl-6-azabicyclo[3.2.0]hepta-3,6-diene |
|---|---|
| PubChem CID | 101141415 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 4,7-ditert-butyl-6-azabicyclo[3.2.0]hepta-3,6-diene |
| SMILES | CC(C)(C)C1=CCC2C(C(C)(C)C)=NC12 |
| InChI | InChI=1S/C14H23N/c1-13(2,3)10-8-7-9-11(10)15-12(9)14(4,5)6/h8-9,11H,7H2,1-6H3 |
| InChIKey | DPRYDIOVQDSKLQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|