C13H23N — CID 123365366
(4Z)-5-hexan-2-yl-4-propylidene-2,3-dihydropyrrole (PubChem CID 123365366) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (4Z)-5-hexan-2-yl-4-propylidene-2,3-dihydropyrrole.
| Compound Name | (4Z)-5-hexan-2-yl-4-propylidene-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 123365366 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (4Z)-5-hexan-2-yl-4-propylidene-2,3-dihydropyrrole |
| SMILES | CC/C=C1/CCN=C1C(C)CCCC |
| InChI | InChI=1S/C13H23N/c1-4-6-8-11(3)13-12(7-5-2)9-10-14-13/h7,11H,4-6,8-10H2,1-3H3/b12-7- |
| InChIKey | NYWQNFSEVSCYSS-GHXNOFRVSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |