C21H35N3O3 — CID 176962467
tert-butyl 7-[4-(2-methoxyethylamino)butyl]-4-methyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 176962467) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is tert-butyl 7-[4-(2-methoxyethylamino)butyl]-4-methyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 7-[4-(2-methoxyethylamino)butyl]-4-methyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 176962467 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | tert-butyl 7-[4-(2-methoxyethylamino)butyl]-4-methyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | COCCNCCCCc1ccc2c(n1)N(C(=O)OC(C)(C)C)CCC2C |
| InChI | InChI=1S/C21H35N3O3/c1-16-11-14-24(20(25)27-21(2,3)4)19-18(16)10-9-17(23-19)8-6-7-12-22-13-15-26-5/h9-10,16,22H,6-8,11-15H2,1-5H3 |
| InChIKey | WVFBTRUFAKWZCD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|