C24H31N5O3 — CID 176964547
N-methyl-5-[4-[(1R,3R)-3-(5-oxo-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-7-yl)cyclopentyl]piperazin-1-yl]pyridine-2-carboxamide (PubChem CID 176964547) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-methyl-5-[4-[(1R,3R)-3-(5-oxo-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-7-yl)cyclopentyl]piperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | N-methyl-5-[4-[(1R,3R)-3-(5-oxo-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-7-yl)cyclopentyl]piperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176964547 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | N-methyl-5-[4-[(1R,3R)-3-(5-oxo-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-7-yl)cyclopentyl]piperazin-1-yl]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(N2CCN([C@@H]3CC[C@@H](c4cc5c(c(=O)[nH]4)CCCO5)C3)CC2)cn1 |
| InChI | InChI=1S/C24H31N5O3/c1-25-24(31)20-7-6-18(15-26-20)29-10-8-28(9-11-29)17-5-4-16(13-17)21-14-22-19(23(30)27-21)3-2-12-32-22/h6-7,14-17H,2-5,8-13H2,1H3,(H,25,31)(H,27,30)/t16-,17-/m1/s1 |
| InChIKey | UTZUVBHCEXKZPI-IAGOWNOFSA-N |
| XLogP | 1.91 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |