C14H25N — CID 176966971
ethane;N-(3-methyl-2-prop-1-en-2-ylbuta-1,3-dienyl)butan-2-imine (PubChem CID 176966971) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is ethane;N-(3-methyl-2-prop-1-en-2-ylbuta-1,3-dienyl)butan-2-imine.
| Compound Name | ethane;N-(3-methyl-2-prop-1-en-2-ylbuta-1,3-dienyl)butan-2-imine |
|---|---|
| PubChem CID | 176966971 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | ethane;N-(3-methyl-2-prop-1-en-2-ylbuta-1,3-dienyl)butan-2-imine |
| SMILES | C=C(C)C(=C/N=C(\C)CC)C(=C)C.CC |
| InChI | InChI=1S/C12H19N.C2H6/c1-7-11(6)13-8-12(9(2)3)10(4)5;1-2/h8H,2,4,7H2,1,3,5-6H3;1-2H3/b13-11+; |
| InChIKey | BBKNZGCVSBJNRX-BNSHTTSQSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|