C14H22F2N2 — CID 174319468
(E)-1,1-difluoro-2-N,5-dimethyl-4-methylidene-6-N-pentan-2-ylidenehex-5-ene-2,6-diimine (PubChem CID 174319468) has the molecular formula C14H22F2N2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (E)-1,1-difluoro-2-N,5-dimethyl-4-methylidene-6-N-pentan-2-ylidenehex-5-ene-2,6-diimine.
| Compound Name | (E)-1,1-difluoro-2-N,5-dimethyl-4-methylidene-6-N-pentan-2-ylidenehex-5-ene-2,6-diimine |
|---|---|
| PubChem CID | 174319468 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (E)-1,1-difluoro-2-N,5-dimethyl-4-methylidene-6-N-pentan-2-ylidenehex-5-ene-2,6-diimine |
| SMILES | C=C(C/C(=N/C)C(F)F)/C(C)=C/N=C(\C)CCC |
| InChI | InChI=1S/C14H22F2N2/c1-6-7-12(4)18-9-11(3)10(2)8-13(17-5)14(15)16/h9,14H,2,6-8H2,1,3-5H3/b11-9+,17-13-,18-12+ |
| InChIKey | YQKMAJYNMPDSOI-ZWKJPMDJSA-N |
| XLogP | 4.43 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|