C11H16F3N — CID 168972591
N-[(Z)-5,5,5-trifluoro-3-methylidenepent-1-enyl]pentan-2-imine (PubChem CID 168972591) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is N-[(Z)-5,5,5-trifluoro-3-methylidenepent-1-enyl]pentan-2-imine.
| Compound Name | N-[(Z)-5,5,5-trifluoro-3-methylidenepent-1-enyl]pentan-2-imine |
|---|---|
| PubChem CID | 168972591 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | N-[(Z)-5,5,5-trifluoro-3-methylidenepent-1-enyl]pentan-2-imine |
| SMILES | C=C(/C=C\N=C(/C)CCC)CC(F)(F)F |
| InChI | InChI=1S/C11H16F3N/c1-4-5-10(3)15-7-6-9(2)8-11(12,13)14/h6-7H,2,4-5,8H2,1,3H3/b7-6-,15-10+ |
| InChIKey | DRKFKFHWAFFXPG-GZJRMXIGSA-N |
| XLogP | 4.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|