C33H51FN4O3 — CID 176967572
N-[(2E,4E,6E)-2-ethenyl-5-ethyl-6-[1-(ethylideneamino)ethylidene]deca-2,4-dienyl]-1-[2-[(1-fluorocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide (PubChem CID 176967572) has the molecular formula C33H51FN4O3 and a molecular weight of 570.79 g/mol. Its IUPAC name is N-[(2E,4E,6E)-2-ethenyl-5-ethyl-6-[1-(ethylideneamino)ethylidene]deca-2,4-dienyl]-1-[2-[(1-fluorocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(2E,4E,6E)-2-ethenyl-5-ethyl-6-[1-(ethylideneamino)ethylidene]deca-2,4-dienyl]-1-[2-[(1-fluorocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 176967572 |
| Molecular Formula | C33H51FN4O3 |
| Molecular Weight | 570.79 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | N-[(2E,4E,6E)-2-ethenyl-5-ethyl-6-[1-(ethylideneamino)ethylidene]deca-2,4-dienyl]-1-[2-[(1-fluorocyclopropanecarbonyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carboxamide |
| SMILES | C=C/C(=C\C=C(CC)\C(CCCC)=C(C)\N=C\C)CNC(=O)C1CCCN1C(=O)C(NC(=O)C1(F)CC1)C(C)(C)C |
| InChI | InChI=1S/C33H51FN4O3/c1-9-13-15-26(23(5)35-12-4)25(11-3)18-17-24(10-2)22-36-29(39)27-16-14-21-38(27)30(40)28(32(6,7)8)37-31(41)33(34)19-20-33/h10,12,17-18,27-28H,2,9,11,13-16,19-22H2,1,3-8H3,(H,36,39)(H,37,41)/b24-17+,25-18+,26-23+,35-12+ |
| InChIKey | NWYDTYGUEWSRBE-LRMJHIDASA-N |
| XLogP | 6.13 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.79 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|