C26H38ClNO2S — CID 176967855
1-(4-chloro-3-methylphenyl)butyl propanoate;ethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-methyl-1,2-thiazole (PubChem CID 176967855) has the molecular formula C26H38ClNO2S and a molecular weight of 464.12 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)butyl propanoate;ethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-methyl-1,2-thiazole.
| Compound Name | 1-(4-chloro-3-methylphenyl)butyl propanoate;ethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-methyl-1,2-thiazole |
|---|---|
| PubChem CID | 176967855 |
| Molecular Formula | C26H38ClNO2S |
| Molecular Weight | 464.12 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)butyl propanoate;ethane;3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-methyl-1,2-thiazole |
| SMILES | C/C=C\C(=C/C)c1cc(C)sn1.CC.CCCC(OC(=O)CC)c1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C14H19ClO2.C10H13NS.C2H6/c1-4-6-13(17-14(16)5-2)11-7-8-12(15)10(3)9-11;1-4-6-9(5-2)10-7-8(3)12-11-10;1-2/h7-9,13H,4-6H2,1-3H3;4-7H,1-3H3;1-2H3/b;6-4-,9-5+; |
| InChIKey | FWYLBOJUWBOBLF-ZCVWDLRESA-N |
| XLogP | 8.90 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.12 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|