C13H12ClNO2S — CID 44603814
[(1R)-1-[3-(4-chlorophenyl)-1,2-thiazol-5-yl]ethyl] acetate (PubChem CID 44603814) has the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. Its IUPAC name is [(1R)-1-[3-(4-chlorophenyl)-1,2-thiazol-5-yl]ethyl] acetate.
| Compound Name | [(1R)-1-[3-(4-chlorophenyl)-1,2-thiazol-5-yl]ethyl] acetate |
|---|---|
| PubChem CID | 44603814 |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | [(1R)-1-[3-(4-chlorophenyl)-1,2-thiazol-5-yl]ethyl] acetate |
| SMILES | CC(=O)O[C@H](C)c1cc(-c2ccc(Cl)cc2)ns1 |
| InChI | InChI=1S/C13H12ClNO2S/c1-8(17-9(2)16)13-7-12(15-18-13)10-3-5-11(14)6-4-10/h3-8H,1-2H3/t8-/m1/s1 |
| InChIKey | FGOSXYFDQFRCLB-MRVPVSSYSA-N |
| XLogP | 4.09 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |