C11H13FNOP — CID 176969199
4-(4-fluoro-3-phosphanylphenyl)piperidin-2-one (PubChem CID 176969199) has the molecular formula C11H13FNOP and a molecular weight of 225.20 g/mol. Its IUPAC name is 4-(4-fluoro-3-phosphanylphenyl)piperidin-2-one.
| Compound Name | 4-(4-fluoro-3-phosphanylphenyl)piperidin-2-one |
|---|---|
| PubChem CID | 176969199 |
| Molecular Formula | C11H13FNOP |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 4-(4-fluoro-3-phosphanylphenyl)piperidin-2-one |
| SMILES | O=C1CC(c2ccc(F)c(P)c2)CCN1 |
| InChI | InChI=1S/C11H13FNOP/c12-9-2-1-7(5-10(9)15)8-3-4-13-11(14)6-8/h1-2,5,8H,3-4,6,15H2,(H,13,14) |
| InChIKey | IJJFSPLAZMNDNI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|