C11H13FNO2P — CID 142000827
(6S)-5-(4-fluoro-3-phosphanylphenyl)-6-methylmorpholin-3-one (PubChem CID 142000827) has the molecular formula C11H13FNO2P and a molecular weight of 241.20 g/mol. Its IUPAC name is (6S)-5-(4-fluoro-3-phosphanylphenyl)-6-methylmorpholin-3-one.
| Compound Name | (6S)-5-(4-fluoro-3-phosphanylphenyl)-6-methylmorpholin-3-one |
|---|---|
| PubChem CID | 142000827 |
| Molecular Formula | C11H13FNO2P |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | (6S)-5-(4-fluoro-3-phosphanylphenyl)-6-methylmorpholin-3-one |
| SMILES | C[C@@H]1OCC(=O)NC1c1ccc(F)c(P)c1 |
| InChI | InChI=1S/C11H13FNO2P/c1-6-11(13-10(14)5-15-6)7-2-3-8(12)9(16)4-7/h2-4,6,11H,5,16H2,1H3,(H,13,14)/t6-,11?/m0/s1 |
| InChIKey | BIIKMJIPWDIQTG-OCAOPBLFSA-N |
| XLogP | 0.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|