C24H25Cl2NO2 — CID 144688158
5,6-bis(4-chlorophenyl)morpholin-3-one;(3Z,5Z)-5-methylhepta-1,3,5-triene (PubChem CID 144688158) has the molecular formula C24H25Cl2NO2 and a molecular weight of 430.38 g/mol. Its IUPAC name is 5,6-bis(4-chlorophenyl)morpholin-3-one;(3Z,5Z)-5-methylhepta-1,3,5-triene.
| Compound Name | 5,6-bis(4-chlorophenyl)morpholin-3-one;(3Z,5Z)-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 144688158 |
| Molecular Formula | C24H25Cl2NO2 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 5,6-bis(4-chlorophenyl)morpholin-3-one;(3Z,5Z)-5-methylhepta-1,3,5-triene |
| SMILES | C=C/C=C\C(C)=C/C.O=C1COC(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C16H13Cl2NO2.C8H12/c17-12-5-1-10(2-6-12)15-16(21-9-14(20)19-15)11-3-7-13(18)8-4-11;1-4-6-7-8(3)5-2/h1-8,15-16H,9H2,(H,19,20);4-7H,1H2,2-3H3/b;7-6-,8-5- |
| InChIKey | RZVSOQSARZOCFM-JLMZEHOHSA-N |
| XLogP | 6.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|