C10H7F2NO3 — CID 101415585
(4S)-4-(3,4-difluorophenyl)-1,3-oxazinane-2,5-dione (PubChem CID 101415585) has the molecular formula C10H7F2NO3 and a molecular weight of 227.17 g/mol. Its IUPAC name is (4S)-4-(3,4-difluorophenyl)-1,3-oxazinane-2,5-dione.
| Compound Name | (4S)-4-(3,4-difluorophenyl)-1,3-oxazinane-2,5-dione |
|---|---|
| PubChem CID | 101415585 |
| Molecular Formula | C10H7F2NO3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | (4S)-4-(3,4-difluorophenyl)-1,3-oxazinane-2,5-dione |
| SMILES | O=C1N[C@@H](c2ccc(F)c(F)c2)C(=O)CO1 |
| InChI | InChI=1S/C10H7F2NO3/c11-6-2-1-5(3-7(6)12)9-8(14)4-16-10(15)13-9/h1-3,9H,4H2,(H,13,15)/t9-/m0/s1 |
| InChIKey | UIMVRFZYRBSJBH-VIFPVBQESA-N |
| XLogP | 1.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |