C19H25N3O — CID 176969995
ethane;N-[(3R,5R)-5-phenylpiperidin-3-yl]pyridine-2-carboxamide (PubChem CID 176969995) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is ethane;N-[(3R,5R)-5-phenylpiperidin-3-yl]pyridine-2-carboxamide.
| Compound Name | ethane;N-[(3R,5R)-5-phenylpiperidin-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176969995 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | ethane;N-[(3R,5R)-5-phenylpiperidin-3-yl]pyridine-2-carboxamide |
| SMILES | CC.O=C(N[C@H]1CNC[C@@H](c2ccccc2)C1)c1ccccn1 |
| InChI | InChI=1S/C17H19N3O.C2H6/c21-17(16-8-4-5-9-19-16)20-15-10-14(11-18-12-15)13-6-2-1-3-7-13;1-2/h1-9,14-15,18H,10-12H2,(H,20,21);1-2H3/t14-,15+;/m0./s1 |
| InChIKey | OADYLRFKXGAJBZ-LDXVYITESA-N |
| XLogP | 2.98 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |