C19H21N3O3 — CID 170979733
methyl 4-[(3R,5R)-5-(pyridine-2-carbonylamino)piperidin-3-yl]benzoate (PubChem CID 170979733) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is methyl 4-[(3R,5R)-5-(pyridine-2-carbonylamino)piperidin-3-yl]benzoate.
| Compound Name | methyl 4-[(3R,5R)-5-(pyridine-2-carbonylamino)piperidin-3-yl]benzoate |
|---|---|
| PubChem CID | 170979733 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | methyl 4-[(3R,5R)-5-(pyridine-2-carbonylamino)piperidin-3-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2CNC[C@H](NC(=O)c3ccccn3)C2)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-25-19(24)14-7-5-13(6-8-14)15-10-16(12-20-11-15)22-18(23)17-4-2-3-9-21-17/h2-9,15-16,20H,10-12H2,1H3,(H,22,23)/t15-,16+/m0/s1 |
| InChIKey | YOTQISMZSDKZKA-JKSUJKDBSA-N |
| XLogP | 1.74 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |