C18H18N2O2 — CID 72946592
N-[[(1R,2S)-2-(4-acetylphenyl)cyclopropyl]methyl]pyridine-2-carboxamide (PubChem CID 72946592) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[[(1R,2S)-2-(4-acetylphenyl)cyclopropyl]methyl]pyridine-2-carboxamide.
| Compound Name | N-[[(1R,2S)-2-(4-acetylphenyl)cyclopropyl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 72946592 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[[(1R,2S)-2-(4-acetylphenyl)cyclopropyl]methyl]pyridine-2-carboxamide |
| SMILES | CC(=O)c1ccc([C@H]2C[C@H]2CNC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-12(21)13-5-7-14(8-6-13)16-10-15(16)11-20-18(22)17-4-2-3-9-19-17/h2-9,15-16H,10-11H2,1H3,(H,20,22)/t15-,16+/m0/s1 |
| InChIKey | BKECWTITWBLNCU-JKSUJKDBSA-N |
| XLogP | 2.82 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |