C12H16N2O4 — CID 155996114
N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]pyridine-2-carboxamide (PubChem CID 155996114) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]pyridine-2-carboxamide.
| Compound Name | N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155996114 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]methyl]pyridine-2-carboxamide |
| SMILES | O=C(NC[C@@H]1COC[C@@H](O)[C@H]1O)c1ccccn1 |
| InChI | InChI=1S/C12H16N2O4/c15-10-7-18-6-8(11(10)16)5-14-12(17)9-3-1-2-4-13-9/h1-4,8,10-11,15-16H,5-7H2,(H,14,17)/t8-,10-,11+/m1/s1 |
| InChIKey | BWMCIMYLCAKINW-IEBDPFPHSA-N |
| XLogP | -0.82 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |