C25H31N3O4 — CID 146167718
methyl 4-[3-(tert-butylcarbamoyl)-3-(pyridine-2-carbonylamino)cyclohexyl]benzoate (PubChem CID 146167718) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is methyl 4-[3-(tert-butylcarbamoyl)-3-(pyridine-2-carbonylamino)cyclohexyl]benzoate.
| Compound Name | methyl 4-[3-(tert-butylcarbamoyl)-3-(pyridine-2-carbonylamino)cyclohexyl]benzoate |
|---|---|
| PubChem CID | 146167718 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | methyl 4-[3-(tert-butylcarbamoyl)-3-(pyridine-2-carbonylamino)cyclohexyl]benzoate |
| SMILES | COC(=O)c1ccc(C2CCCC(NC(=O)c3ccccn3)(C(=O)NC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C25H31N3O4/c1-24(2,3)28-23(31)25(27-21(29)20-9-5-6-15-26-20)14-7-8-19(16-25)17-10-12-18(13-11-17)22(30)32-4/h5-6,9-13,15,19H,7-8,14,16H2,1-4H3,(H,27,29)(H,28,31) |
| InChIKey | ISHOWJRFDSYPQZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |