C24H34N2O3 — CID 135008716
methyl 3-[(1E)-cyclodecen-1-yl]-1-(pyridine-2-carbonylamino)cyclohexane-1-carboxylate (PubChem CID 135008716) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is methyl 3-[(1E)-cyclodecen-1-yl]-1-(pyridine-2-carbonylamino)cyclohexane-1-carboxylate.
| Compound Name | methyl 3-[(1E)-cyclodecen-1-yl]-1-(pyridine-2-carbonylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 135008716 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | methyl 3-[(1E)-cyclodecen-1-yl]-1-(pyridine-2-carbonylamino)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2ccccn2)CCCC(/C2=C/CCCCCCCC2)C1 |
| InChI | InChI=1S/C24H34N2O3/c1-29-23(28)24(26-22(27)21-15-9-10-17-25-21)16-11-14-20(18-24)19-12-7-5-3-2-4-6-8-13-19/h9-10,12,15,17,20H,2-8,11,13-14,16,18H2,1H3,(H,26,27)/b19-12+ |
| InChIKey | YYDNGEXUYZDYCT-XDHOZWIPSA-N |
| XLogP | 4.97 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|