C29H44FN4O5+ — CID 176970312
(4-carboxy-5-fluoro-2-methoxyanilino)-[(E)-1-[(E)-[(E)-3-[(4,4-dimethylcyclohexyl)methyliminomethyl]-5-methylhept-2-en-4-ylidene]amino]prop-1-enyl]-dihydroxyazanium (PubChem CID 176970312) has the molecular formula C29H44FN4O5+ and a molecular weight of 547.69 g/mol. Its IUPAC name is (4-carboxy-5-fluoro-2-methoxyanilino)-[(E)-1-[(E)-[(E)-3-[(4,4-dimethylcyclohexyl)methyliminomethyl]-5-methylhept-2-en-4-ylidene]amino]prop-1-enyl]-dihydroxyazanium.
| Compound Name | (4-carboxy-5-fluoro-2-methoxyanilino)-[(E)-1-[(E)-[(E)-3-[(4,4-dimethylcyclohexyl)methyliminomethyl]-5-methylhept-2-en-4-ylidene]amino]prop-1-enyl]-dihydroxyazanium |
|---|---|
| PubChem CID | 176970312 |
| Molecular Formula | C29H44FN4O5+ |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | (4-carboxy-5-fluoro-2-methoxyanilino)-[(E)-1-[(E)-[(E)-3-[(4,4-dimethylcyclohexyl)methyliminomethyl]-5-methylhept-2-en-4-ylidene]amino]prop-1-enyl]-dihydroxyazanium |
| SMILES | C/C=C(\C=N\CC1CCC(C)(C)CC1)C(=N/C(=C\C)[N+](O)(O)Nc1cc(F)c(C(=O)O)cc1OC)/C(C)CC |
| InChI | InChI=1S/C29H43FN4O5/c1-8-19(4)27(21(9-2)18-31-17-20-11-13-29(5,6)14-12-20)32-26(10-3)34(37,38)33-24-16-23(30)22(28(35)36)15-25(24)39-7/h9-10,15-16,18-20,33,37-38H,8,11-14,17H2,1-7H3/p+1/b21-9+,26-10+,31-18+,32-27+ |
| InChIKey | FRTNZLHFXXEQKA-KITIYLNGSA-O |
| XLogP | 7.04 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|