C26H30F2N3O5S+ — CID 176970401
(4-carboxy-5-fluoro-2-methoxyanilino)-[2-[4-(4,4-dimethylcyclohexyl)-2-(fluoromethyl)phenyl]-1,3-thiazol-4-yl]-dihydroxyazanium (PubChem CID 176970401) has the molecular formula C26H30F2N3O5S+ and a molecular weight of 534.61 g/mol. Its IUPAC name is (4-carboxy-5-fluoro-2-methoxyanilino)-[2-[4-(4,4-dimethylcyclohexyl)-2-(fluoromethyl)phenyl]-1,3-thiazol-4-yl]-dihydroxyazanium.
| Compound Name | (4-carboxy-5-fluoro-2-methoxyanilino)-[2-[4-(4,4-dimethylcyclohexyl)-2-(fluoromethyl)phenyl]-1,3-thiazol-4-yl]-dihydroxyazanium |
|---|---|
| PubChem CID | 176970401 |
| Molecular Formula | C26H30F2N3O5S+ |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | (4-carboxy-5-fluoro-2-methoxyanilino)-[2-[4-(4,4-dimethylcyclohexyl)-2-(fluoromethyl)phenyl]-1,3-thiazol-4-yl]-dihydroxyazanium |
| SMILES | COc1cc(C(=O)O)c(F)cc1N[N+](O)(O)c1csc(-c2ccc(C3CCC(C)(C)CC3)cc2CF)n1 |
| InChI | InChI=1S/C26H29F2N3O5S/c1-26(2)8-6-15(7-9-26)16-4-5-18(17(10-16)13-27)24-29-23(14-37-24)31(34,35)30-21-12-20(28)19(25(32)33)11-22(21)36-3/h4-5,10-12,14-15,30,34-35H,6-9,13H2,1-3H3/p+1 |
| InChIKey | VTBLYJJAMGCSHE-UHFFFAOYSA-O |
| XLogP | 6.92 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|