C22H39NO2 — CID 176970758
butane;methyl (E)-2-[[(E,3Z)-3-ethylidene-5,6,6-trimethylhept-4-en-2-ylidene]amino]pent-2-enoate (PubChem CID 176970758) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is butane;methyl (E)-2-[[(E,3Z)-3-ethylidene-5,6,6-trimethylhept-4-en-2-ylidene]amino]pent-2-enoate.
| Compound Name | butane;methyl (E)-2-[[(E,3Z)-3-ethylidene-5,6,6-trimethylhept-4-en-2-ylidene]amino]pent-2-enoate |
|---|---|
| PubChem CID | 176970758 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | butane;methyl (E)-2-[[(E,3Z)-3-ethylidene-5,6,6-trimethylhept-4-en-2-ylidene]amino]pent-2-enoate |
| SMILES | C/C=C(/C=C(\C)C(C)(C)C)C(\C)=N\C(=C\CC)C(=O)OC.CCCC |
| InChI | InChI=1S/C18H29NO2.C4H10/c1-9-11-16(17(20)21-8)19-14(4)15(10-2)12-13(3)18(5,6)7;1-3-4-2/h10-12H,9H2,1-8H3;3-4H2,1-2H3/b13-12+,15-10-,16-11+,19-14+; |
| InChIKey | ODWPRWWYPMLVSR-FFDNSTFOSA-N |
| XLogP | 6.66 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|