C16H20N2O4S — CID 176975702
(2S)-6-amino-2-(1-benzothiophen-2-ylmethoxycarbonylamino)hexanoic acid (PubChem CID 176975702) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is (2S)-6-amino-2-(1-benzothiophen-2-ylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-6-amino-2-(1-benzothiophen-2-ylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 176975702 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2S)-6-amino-2-(1-benzothiophen-2-ylmethoxycarbonylamino)hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)OCc1cc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C16H20N2O4S/c17-8-4-3-6-13(15(19)20)18-16(21)22-10-12-9-11-5-1-2-7-14(11)23-12/h1-2,5,7,9,13H,3-4,6,8,10,17H2,(H,18,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | DMAOSPVQTGDESZ-ZDUSSCGKSA-N |
| XLogP | 2.71 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|