C19H23NO4S — CID 69893793
tert-butyl (2S)-2-(phenylmethoxycarbonylamino)-3-thiophen-2-ylpropanoate (PubChem CID 69893793) has the molecular formula C19H23NO4S and a molecular weight of 361.50 g/mol. Its IUPAC name is tert-butyl (2S)-2-(phenylmethoxycarbonylamino)-3-thiophen-2-ylpropanoate.
| Compound Name | tert-butyl (2S)-2-(phenylmethoxycarbonylamino)-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 69893793 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | tert-butyl (2S)-2-(phenylmethoxycarbonylamino)-3-thiophen-2-ylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=CC=CS1)NC(=O)OCC2=CC=CC=C2 |
| InChI | InChI=1S/C19H23NO4S/c1-19(2,3)24-17(21)16(12-15-10-7-11-25-15)20-18(22)23-13-14-8-5-4-6-9-14/h4-11,16H,12-13H2,1-3H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | HSKSHQWIRZOLMM-INIZCTEOSA-N |
| XLogP | 4.10 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | 443 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |