C30H40N4O7S — CID 6478315
4-[2-(2-Benzyloxycarbonylamino-4-methyl-pentanoylamino)-3-thiophen-2-yl-propionylamino]-6-carbamoyl-hex-2-enoic acid, ethyl ester (PubChem CID 6478315) has the molecular formula C30H40N4O7S and a molecular weight of 600.70 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-thiophen-2-ylpropanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | 4-[2-(2-Benzyloxycarbonylamino-4-methyl-pentanoylamino)-3-thiophen-2-yl-propionylamino]-6-carbamoyl-hex-2-enoic acid, ethyl ester |
|---|---|
| PubChem CID | 6478315 |
| Molecular Formula | C30H40N4O7S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-thiophen-2-ylpropanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(=O)N)NC(=O)[C@H](CC1=CC=CS1)NC(=O)[C@H](CC(C)C)NC(=O)OCC2=CC=CC=C2 |
| InChI | InChI=1S/C30H40N4O7S/c1-4-40-27(36)15-13-22(12-14-26(31)35)32-28(37)25(18-23-11-8-16-42-23)33-29(38)24(17-20(2)3)34-30(39)41-19-21-9-6-5-7-10-21/h5-11,13,15-16,20,22,24-25H,4,12,14,17-19H2,1-3H3,(H2,31,35)(H,32,37)(H,33,38)(H,34,39)/b15-13+/t22-,24-,25-/m0/s1 |
| InChIKey | DVBGBXXFPYXTFE-DEUOMTTOSA-N |
| XLogP | 3.30 |
| TPSA | 194.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | 923 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|