C21H30BrFN4O2 — CID 176976111
7-bromo-8-fluoro-6-methyl-4-(4-methylpiperazin-1-yl)-2-(oxan-4-yloxy)quinazoline;ethane (PubChem CID 176976111) has the molecular formula C21H30BrFN4O2 and a molecular weight of 469.40 g/mol. Its IUPAC name is 7-bromo-8-fluoro-6-methyl-4-(4-methylpiperazin-1-yl)-2-(oxan-4-yloxy)quinazoline;ethane.
| Compound Name | 7-bromo-8-fluoro-6-methyl-4-(4-methylpiperazin-1-yl)-2-(oxan-4-yloxy)quinazoline;ethane |
|---|---|
| PubChem CID | 176976111 |
| Molecular Formula | C21H30BrFN4O2 |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 7-bromo-8-fluoro-6-methyl-4-(4-methylpiperazin-1-yl)-2-(oxan-4-yloxy)quinazoline;ethane |
| SMILES | CC.Cc1cc2c(N3CCN(C)CC3)nc(OC3CCOCC3)nc2c(F)c1Br |
| InChI | InChI=1S/C19H24BrFN4O2.C2H6/c1-12-11-14-17(16(21)15(12)20)22-19(27-13-3-9-26-10-4-13)23-18(14)25-7-5-24(2)6-8-25;1-2/h11,13H,3-10H2,1-2H3;1-2H3 |
| InChIKey | HPNRGMGALLNPDH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |