C21H26N2O2 — CID 176977571
ethane;ethyl 6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),3,5,10,12(16),13-heptaene-4-carboxylate (PubChem CID 176977571) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is ethane;ethyl 6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),3,5,10,12(16),13-heptaene-4-carboxylate.
| Compound Name | ethane;ethyl 6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),3,5,10,12(16),13-heptaene-4-carboxylate |
|---|---|
| PubChem CID | 176977571 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | ethane;ethyl 6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),3,5,10,12(16),13-heptaene-4-carboxylate |
| SMILES | CC.CC.CCOC(=O)c1cnc2c(c1)-c1cccc3ccn(c13)C2 |
| InChI | InChI=1S/C17H14N2O2.2C2H6/c1-2-21-17(20)12-8-14-13-5-3-4-11-6-7-19(16(11)13)10-15(14)18-9-12;2*1-2/h3-9H,2,10H2,1H3;2*1-2H3 |
| InChIKey | JDRXPTCKTRYIID-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |