C22H30F2N4O — CID 176983099
3-[7-(difluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-1-propyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carbaldehyde;ethane (PubChem CID 176983099) has the molecular formula C22H30F2N4O and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-[7-(difluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-1-propyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carbaldehyde;ethane.
| Compound Name | 3-[7-(difluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-1-propyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carbaldehyde;ethane |
|---|---|
| PubChem CID | 176983099 |
| Molecular Formula | C22H30F2N4O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 3-[7-(difluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]-1-propyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carbaldehyde;ethane |
| SMILES | CC.CCCn1nc(N2CCCc3ccc(C(F)F)cc32)c2c1CCN(C=O)C2 |
| InChI | InChI=1S/C20H24F2N4O.C2H6/c1-2-8-26-17-7-10-24(13-27)12-16(17)20(23-26)25-9-3-4-14-5-6-15(19(21)22)11-18(14)25;1-2/h5-6,11,13,19H,2-4,7-10,12H2,1H3;1-2H3 |
| InChIKey | DLOLPKQEHXTXSC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|