C23H33N5O — CID 176985503
ethane;1-(1-ethyl-5-formyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)-3,4-dihydro-2H-quinoline-6-carbonitrile (PubChem CID 176985503) has the molecular formula C23H33N5O and a molecular weight of 395.55 g/mol. Its IUPAC name is ethane;1-(1-ethyl-5-formyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)-3,4-dihydro-2H-quinoline-6-carbonitrile.
| Compound Name | ethane;1-(1-ethyl-5-formyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)-3,4-dihydro-2H-quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 176985503 |
| Molecular Formula | C23H33N5O |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | ethane;1-(1-ethyl-5-formyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl)-3,4-dihydro-2H-quinoline-6-carbonitrile |
| SMILES | CC.CC.CCn1nc(N2CCCc3cc(C#N)ccc32)c2c1CCN(C=O)C2 |
| InChI | InChI=1S/C19H21N5O.2C2H6/c1-2-24-18-7-9-22(13-25)12-16(18)19(21-24)23-8-3-4-15-10-14(11-20)5-6-17(15)23;2*1-2/h5-6,10,13H,2-4,7-9,12H2,1H3;2*1-2H3 |
| InChIKey | QFNVSRHBDGKRFV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|