C13H24N2 — CID 176983570
ethane;(2E)-N-ethenyl-1-ethyl-2-ethylidenepiperidin-3-imine (PubChem CID 176983570) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;(2E)-N-ethenyl-1-ethyl-2-ethylidenepiperidin-3-imine.
| Compound Name | ethane;(2E)-N-ethenyl-1-ethyl-2-ethylidenepiperidin-3-imine |
|---|---|
| PubChem CID | 176983570 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;(2E)-N-ethenyl-1-ethyl-2-ethylidenepiperidin-3-imine |
| SMILES | C=C/N=C1\CCCN(CC)\C1=C\C.CC |
| InChI | InChI=1S/C11H18N2.C2H6/c1-4-11-10(12-5-2)8-7-9-13(11)6-3;1-2/h4-5H,2,6-9H2,1,3H3;1-2H3/b11-4+,12-10+; |
| InChIKey | BBWZXKSVYBBNKF-ZXJCDKFVSA-N |
| XLogP | 3.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|