About 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene
7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene (PubChem CID 176984351) has the molecular formula C18H34N2
and a molecular weight of 278.48 g/mol. Its IUPAC name is 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene.
Molecular Properties
| Compound Name | 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene |
| PubChem CID | 176984351 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene |
| SMILES | C=C.CC(C)N1CC2(CCN(C3CCCCC3)CC2)C1 |
| InChI | InChI=1S/C16H30N2.C2H4/c1-14(2)18-12-16(13-18)8-10-17(11-9-16)15-6-4-3-5-7-15;1-2/h14-15H,3-13H2,1-2H3;1-2H2 |
| InChIKey | SZUCGTNIFSPTIA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene?
The IUPAC name of 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene (CID 176984351) is 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene.
What is the SMILES notation for 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene?
The canonical SMILES for 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene is C=C.CC(C)N1CC2(CCN(C3CCCCC3)CC2)C1.
What is the InChIKey of 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene?
The InChIKey is SZUCGTNIFSPTIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2.C2H4/c1-14(2)18-12-16(13-18)8-10-17(11-9-16)15-6-4-3-5-7-15;1-2/h14-15H,3-13H2,1-2H3;1-2H2.
What are the key properties of 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene?
7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene has a molecular weight of 278.48 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclohexyl-2-propan-2-yl-2,7-diazaspiro[3.5]nonane;ethene is sourced from PubChem (CID 176984351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).