C9H10F3N3 — CID 176985460
7-(trifluoromethyl)-3,4-dihydro-2H-1,6-naphthyridin-1-amine (PubChem CID 176985460) has the molecular formula C9H10F3N3 and a molecular weight of 217.19 g/mol. Its IUPAC name is 7-(trifluoromethyl)-3,4-dihydro-2H-1,6-naphthyridin-1-amine.
| Compound Name | 7-(trifluoromethyl)-3,4-dihydro-2H-1,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 176985460 |
| Molecular Formula | C9H10F3N3 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 7-(trifluoromethyl)-3,4-dihydro-2H-1,6-naphthyridin-1-amine |
| SMILES | NN1CCCc2cnc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C9H10F3N3/c10-9(11,12)8-4-7-6(5-14-8)2-1-3-15(7)13/h4-5H,1-3,13H2 |
| InChIKey | LQLVNQLNUQITHB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|