C19H21ClIN4O2- — CID 176985540
N-[4-(3-chloro-4-cyano-2-methylphenoxy)cyclohexyl]-1-methyliodanuidylpyrazole-4-carboxamide (PubChem CID 176985540) has the molecular formula C19H21ClIN4O2- and a molecular weight of 499.76 g/mol. Its IUPAC name is N-[4-(3-chloro-4-cyano-2-methylphenoxy)cyclohexyl]-1-methyliodanuidylpyrazole-4-carboxamide.
| Compound Name | N-[4-(3-chloro-4-cyano-2-methylphenoxy)cyclohexyl]-1-methyliodanuidylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 176985540 |
| Molecular Formula | C19H21ClIN4O2- |
| Molecular Weight | 499.76 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | N-[4-(3-chloro-4-cyano-2-methylphenoxy)cyclohexyl]-1-methyliodanuidylpyrazole-4-carboxamide |
| SMILES | C[I-]n1cc(C(=O)NC2CCC(Oc3ccc(C#N)c(Cl)c3C)CC2)cn1 |
| InChI | InChI=1S/C19H21ClIN4O2/c1-12-17(8-3-13(9-22)18(12)20)27-16-6-4-15(5-7-16)24-19(26)14-10-23-25(11-14)21-2/h3,8,10-11,15-16H,4-7H2,1-2H3,(H,24,26)/q-1 |
| InChIKey | FRFFCNZJWYOXSX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.76 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|