C17H32N4 — CID 176985938
(1E,3Z)-1-[4-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]penta-1,3-diene-1,4-diamine (PubChem CID 176985938) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is (1E,3Z)-1-[4-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-[4-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 176985938 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | (1E,3Z)-1-[4-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCC(CN2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C17H32N4/c1-14-5-9-20(10-6-14)13-16-7-11-21(12-8-16)17(19)4-3-15(2)18/h3-4,14,16H,5-13,18-19H2,1-2H3/b15-3-,17-4+ |
| InChIKey | ODTSHQJWICIRSZ-WDCUMXCNSA-N |
| XLogP | 2.09 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|