C26H33N5O3 — CID 176986308
N-cyclohexyl-6-(4-formylpiperidin-1-yl)pyridazine-3-carboxamide;4-methoxy-2-methylbenzonitrile (PubChem CID 176986308) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-cyclohexyl-6-(4-formylpiperidin-1-yl)pyridazine-3-carboxamide;4-methoxy-2-methylbenzonitrile.
| Compound Name | N-cyclohexyl-6-(4-formylpiperidin-1-yl)pyridazine-3-carboxamide;4-methoxy-2-methylbenzonitrile |
|---|---|
| PubChem CID | 176986308 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | N-cyclohexyl-6-(4-formylpiperidin-1-yl)pyridazine-3-carboxamide;4-methoxy-2-methylbenzonitrile |
| SMILES | COc1ccc(C#N)c(C)c1.O=CC1CCN(c2ccc(C(=O)NC3CCCCC3)nn2)CC1 |
| InChI | InChI=1S/C17H24N4O2.C9H9NO/c22-12-13-8-10-21(11-9-13)16-7-6-15(19-20-16)17(23)18-14-4-2-1-3-5-14;1-7-5-9(11-2)4-3-8(7)6-10/h6-7,12-14H,1-5,8-11H2,(H,18,23);3-5H,1-2H3 |
| InChIKey | HMCAXFOGIWBVLE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|