C16H35N2OY- — CID 176986658
N-[3-methyl-2-(propan-2-ylamino)butyl]formamide;2,2,3-trimethylbutane;yttrium (PubChem CID 176986658) has the molecular formula C16H35N2OY- and a molecular weight of 360.38 g/mol. Its IUPAC name is N-[3-methyl-2-(propan-2-ylamino)butyl]formamide;2,2,3-trimethylbutane;yttrium.
| Compound Name | N-[3-methyl-2-(propan-2-ylamino)butyl]formamide;2,2,3-trimethylbutane;yttrium |
|---|---|
| PubChem CID | 176986658 |
| Molecular Formula | C16H35N2OY- |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-[3-methyl-2-(propan-2-ylamino)butyl]formamide;2,2,3-trimethylbutane;yttrium |
| SMILES | CC(C)NC(CNC=O)C(C)C.C[C-](C)C(C)(C)C.[Y] |
| InChI | InChI=1S/C9H20N2O.C7H15.Y/c1-7(2)9(5-10-6-12)11-8(3)4;1-6(2)7(3,4)5;/h6-9,11H,5H2,1-4H3,(H,10,12);1-5H3;/q;-1; |
| InChIKey | HQNZLABDLCMQQQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|