C34H40N4O3 — CID 176987684
2-[[4-[1-(5-ethyl-1,3-benzoxazol-2-yl)piperidin-4-yl]-8-methylnaphthalen-1-yl]-formylamino]-N-methylhept-6-enamide (PubChem CID 176987684) has the molecular formula C34H40N4O3 and a molecular weight of 552.72 g/mol. Its IUPAC name is 2-[[4-[1-(5-ethyl-1,3-benzoxazol-2-yl)piperidin-4-yl]-8-methylnaphthalen-1-yl]-formylamino]-N-methylhept-6-enamide.
| Compound Name | 2-[[4-[1-(5-ethyl-1,3-benzoxazol-2-yl)piperidin-4-yl]-8-methylnaphthalen-1-yl]-formylamino]-N-methylhept-6-enamide |
|---|---|
| PubChem CID | 176987684 |
| Molecular Formula | C34H40N4O3 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | 2-[[4-[1-(5-ethyl-1,3-benzoxazol-2-yl)piperidin-4-yl]-8-methylnaphthalen-1-yl]-formylamino]-N-methylhept-6-enamide |
| SMILES | C=CCCCC(C(=O)NC)N(C=O)c1ccc(C2CCN(c3nc4cc(CC)ccc4o3)CC2)c2cccc(C)c12 |
| InChI | InChI=1S/C34H40N4O3/c1-5-7-8-12-30(33(40)35-4)38(22-39)29-15-14-26(27-11-9-10-23(3)32(27)29)25-17-19-37(20-18-25)34-36-28-21-24(6-2)13-16-31(28)41-34/h5,9-11,13-16,21-22,25,30H,1,6-8,12,17-20H2,2-4H3,(H,35,40) |
| InChIKey | DHXAWHQZUBJCKY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|