C13H16ClN3O2S — CID 176987845
(2-piperidin-1-yl-3H-benzimidazol-5-yl)methanesulfonyl chloride (PubChem CID 176987845) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is (2-piperidin-1-yl-3H-benzimidazol-5-yl)methanesulfonyl chloride.
| Compound Name | (2-piperidin-1-yl-3H-benzimidazol-5-yl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 176987845 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (2-piperidin-1-yl-3H-benzimidazol-5-yl)methanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1ccc2nc(N3CCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C13H16ClN3O2S/c14-20(18,19)9-10-4-5-11-12(8-10)16-13(15-11)17-6-2-1-3-7-17/h4-5,8H,1-3,6-7,9H2,(H,15,16) |
| InChIKey | UNBDZWMOXWMXPW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |